C24H25NO3 — CID 110161842
2-[2-(4-methylphenyl)ethyl]-6-(2-propoxyphenyl)pyridine-3-carboxylic acid (PubChem CID 110161842) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)ethyl]-6-(2-propoxyphenyl)pyridine-3-carboxylic acid.
| Compound Name | 2-[2-(4-methylphenyl)ethyl]-6-(2-propoxyphenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 110161842 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[2-(4-methylphenyl)ethyl]-6-(2-propoxyphenyl)pyridine-3-carboxylic acid |
| SMILES | CCCOc1ccccc1-c1ccc(C(=O)O)c(CCc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C24H25NO3/c1-3-16-28-23-7-5-4-6-19(23)21-15-13-20(24(26)27)22(25-21)14-12-18-10-8-17(2)9-11-18/h4-11,13,15H,3,12,14,16H2,1-2H3,(H,26,27) |
| InChIKey | ZETVZMATVAATQC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |