C25H36N2O5Si — CID 11016193
dimethyl (4aR,5R,5aS,11aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,4,4a,5,5a,11a-hexahydro-2H-pyrido[3,2-b]carbazole-1,6-dicarboxylate (PubChem CID 11016193) has the molecular formula C25H36N2O5Si and a molecular weight of 472.66 g/mol. Its IUPAC name is dimethyl (4aR,5R,5aS,11aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,4,4a,5,5a,11a-hexahydro-2H-pyrido[3,2-b]carbazole-1,6-dicarboxylate.
| Compound Name | dimethyl (4aR,5R,5aS,11aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,4,4a,5,5a,11a-hexahydro-2H-pyrido[3,2-b]carbazole-1,6-dicarboxylate |
|---|---|
| PubChem CID | 11016193 |
| Molecular Formula | C25H36N2O5Si |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | dimethyl (4aR,5R,5aS,11aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,4,4a,5,5a,11a-hexahydro-2H-pyrido[3,2-b]carbazole-1,6-dicarboxylate |
| SMILES | COC(=O)N1CCC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3C(=C[C@H]21)c1ccccc1N3C(=O)OC |
| InChI | InChI=1S/C25H36N2O5Si/c1-25(2,3)33(6,7)32-22-17-12-10-14-26(23(28)30-4)20(17)15-18-16-11-8-9-13-19(16)27(21(18)22)24(29)31-5/h8-9,11,13,15,17,20-22H,10,12,14H2,1-7H3/t17-,20-,21+,22-/m1/s1 |
| InChIKey | MKWRZOLZDNZIKI-HLRQEUIKSA-N |
| XLogP | 5.28 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|