C29H30FNO4 — CID 11016235
tert-butyl (3S,5S)-3-fluoro-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 11016235) has the molecular formula C29H30FNO4 and a molecular weight of 475.56 g/mol. Its IUPAC name is tert-butyl (3S,5S)-3-fluoro-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5S)-3-fluoro-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11016235 |
| Molecular Formula | C29H30FNO4 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | tert-butyl (3S,5S)-3-fluoro-2-oxo-5-(trityloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H](F)C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30FNO4/c1-28(2,3)35-27(33)31-24(19-25(30)26(31)32)20-34-29(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24-25H,19-20H2,1-3H3/t24-,25-/m0/s1 |
| InChIKey | DBHIQFSYZNGWJS-DQEYMECFSA-N |
| XLogP | 5.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|