C18H23N5O4 — CID 11016405
prop-2-enyl (Z)-5-acetamido-2-benzamido-4-(diaminomethylideneamino)pent-2-enoate (PubChem CID 11016405) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is prop-2-enyl (Z)-5-acetamido-2-benzamido-4-(diaminomethylideneamino)pent-2-enoate.
| Compound Name | prop-2-enyl (Z)-5-acetamido-2-benzamido-4-(diaminomethylideneamino)pent-2-enoate |
|---|---|
| PubChem CID | 11016405 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | prop-2-enyl (Z)-5-acetamido-2-benzamido-4-(diaminomethylideneamino)pent-2-enoate |
| SMILES | C=CCOC(=O)/C(=C/C(CNC(C)=O)N=C(N)N)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23N5O4/c1-3-9-27-17(26)15(23-16(25)13-7-5-4-6-8-13)10-14(22-18(19)20)11-21-12(2)24/h3-8,10,14H,1,9,11H2,2H3,(H,21,24)(H,23,25)(H4,19,20,22)/b15-10- |
| InChIKey | UNRYUXKTICNPFH-GDNBJRDFSA-N |
| XLogP | -0.19 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|