C20H26O12S — CID 11016441
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 11016441) has the molecular formula C20H26O12S and a molecular weight of 490.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11016441 |
| Molecular Formula | C20H26O12S |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(1R,2S,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl]sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S[C@H]2CC(=O)[C@@H]3OC[C@H]2O3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H26O12S/c1-8(21)26-7-14-16(28-9(2)22)17(29-10(3)23)18(30-11(4)24)20(32-14)33-15-5-12(25)19-27-6-13(15)31-19/h13-20H,5-7H2,1-4H3/t13-,14-,15+,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | ILWHSILTMOSREC-SPTLRSEESA-N |
| XLogP | -0.11 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|