C20H26N4O4 — CID 110164811
N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclopentyl]-N-methyl-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide (PubChem CID 110164811) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclopentyl]-N-methyl-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide.
| Compound Name | N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclopentyl]-N-methyl-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110164811 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclopentyl]-N-methyl-5-oxo-1-phenyl-4H-pyrazole-3-carboxamide |
| SMILES | CN(C(=O)C1=NN(c2ccccc2)C(=O)C1)[C@@H]1CC[C@@H](N2CCOCC2)[C@@H]1O |
| InChI | InChI=1S/C20H26N4O4/c1-22(16-7-8-17(19(16)26)23-9-11-28-12-10-23)20(27)15-13-18(25)24(21-15)14-5-3-2-4-6-14/h2-6,16-17,19,26H,7-13H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | OJKNSYYXLAUNDJ-ZHALLVOQSA-N |
| XLogP | 0.46 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'} |
|---|