C28H28Cl2O4 — CID 11016553
(1S,3R,4S,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptane (PubChem CID 11016553) has the molecular formula C28H28Cl2O4 and a molecular weight of 499.43 g/mol. Its IUPAC name is (1S,3R,4S,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptane.
| Compound Name | (1S,3R,4S,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 11016553 |
| Molecular Formula | C28H28Cl2O4 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (1S,3R,4S,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2-oxabicyclo[4.1.0]heptane |
| SMILES | ClC1(Cl)[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C28H28Cl2O4/c29-28(30)24-26(33-18-22-14-8-3-9-15-22)25(32-17-21-12-6-2-7-13-21)23(34-27(24)28)19-31-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | MLWOPDONKKNNFH-ACFIUOAZSA-N |
| XLogP | 5.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|