C27H56O4Si2 — CID 11016578
(2S)-1-[(2S,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]pent-4-en-2-ol (PubChem CID 11016578) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is (2S)-1-[(2S,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]pent-4-en-2-ol.
| Compound Name | (2S)-1-[(2S,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 11016578 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | (2S)-1-[(2S,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@H](O)C[C@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H56O4Si2/c1-13-14-23(28)17-25-19-26(31-33(20(2)3,21(4)5)22(6)7)18-24(30-25)15-16-29-32(11,12)27(8,9)10/h13,20-26,28H,1,14-19H2,2-12H3/t23-,24-,25-,26+/m0/s1 |
| InChIKey | SFXQXTHPMCSYAB-ASDGIDEWSA-N |
| XLogP | 7.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|