C32H27N2O2P — CID 11016585
ethyl 4,4-dicyano-3-phenyl-2-(triphenyl-λ5-phosphanylidene)butanoate (PubChem CID 11016585) has the molecular formula C32H27N2O2P and a molecular weight of 502.55 g/mol. Its IUPAC name is ethyl 4,4-dicyano-3-phenyl-2-(triphenyl-λ5-phosphanylidene)butanoate.
| Compound Name | ethyl 4,4-dicyano-3-phenyl-2-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 11016585 |
| Molecular Formula | C32H27N2O2P |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | ethyl 4,4-dicyano-3-phenyl-2-(triphenyl-λ5-phosphanylidene)butanoate |
| SMILES | CCOC(=O)C(C(c1ccccc1)C(C#N)C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27N2O2P/c1-2-36-32(35)31(30(26(23-33)24-34)25-15-7-3-8-16-25)37(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,26,30H,2H2,1H3 |
| InChIKey | CMHIAEGVTNNHCB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|