C26H29N7O4 — CID 11016601
16-[2-(dimethylamino)ethyl]-5-nitro-10-(2-piperidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione (PubChem CID 11016601) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is 16-[2-(dimethylamino)ethyl]-5-nitro-10-(2-piperidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione.
| Compound Name | 16-[2-(dimethylamino)ethyl]-5-nitro-10-(2-piperidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione |
|---|---|
| PubChem CID | 11016601 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 16-[2-(dimethylamino)ethyl]-5-nitro-10-(2-piperidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2(7),3,5,8,11(19),12,14(18)-heptaene-15,17-dione |
| SMILES | CN(C)CCn1c(=O)c2ccc3c4c(nn3CCN3CCCCC3)c3cc([N+](=O)[O-])ccc3n(c1=O)c24 |
| InChI | InChI=1S/C26H29N7O4/c1-28(2)12-14-30-25(34)18-7-9-21-22-23(27-31(21)15-13-29-10-4-3-5-11-29)19-16-17(33(36)37)6-8-20(19)32(24(18)22)26(30)35/h6-9,16H,3-5,10-15H2,1-2H3 |
| InChIKey | GIMLOZSIANGORW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 110.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|