C16H24N2O4 — CID 110166096
4-(diethylamino)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]-2-hydroxybenzamide (PubChem CID 110166096) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(diethylamino)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]-2-hydroxybenzamide.
| Compound Name | 4-(diethylamino)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 110166096 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-(diethylamino)-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]-2-hydroxybenzamide |
| SMILES | CCN(CC)c1ccc(C(=O)N[C@@H]2CC[C@@H](O)[C@@H]2O)c(O)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-3-18(4-2)10-5-6-11(14(20)9-10)16(22)17-12-7-8-13(19)15(12)21/h5-6,9,12-13,15,19-21H,3-4,7-8H2,1-2H3,(H,17,22)/t12-,13-,15-/m1/s1 |
| InChIKey | WWDOBFXDVFPLCJ-UMVBOHGHSA-N |
| XLogP | 0.85 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |