C29H44O5S — CID 11016617
[(3E,7E)-5,9,9-trimethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-3,7-dienyl]sulfonylbenzene (PubChem CID 11016617) has the molecular formula C29H44O5S and a molecular weight of 504.73 g/mol. Its IUPAC name is [(3E,7E)-5,9,9-trimethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-3,7-dienyl]sulfonylbenzene.
| Compound Name | [(3E,7E)-5,9,9-trimethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-3,7-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11016617 |
| Molecular Formula | C29H44O5S |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | [(3E,7E)-5,9,9-trimethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-3,7-dienyl]sulfonylbenzene |
| SMILES | COC(/C=C(\C)CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1)C/C(C)=C/C(OC)OC |
| InChI | InChI=1S/C29H44O5S/c1-21(17-24(32-6)18-22(2)20-27(33-7)34-8)19-26(28-23(3)13-12-16-29(28,4)5)35(30,31)25-14-10-9-11-15-25/h9-11,14-15,17,20,24,26-27H,12-13,16,18-19H2,1-8H3/b21-17+,22-20+ |
| InChIKey | VALIKTZZBWVYBX-VHEBTWEJSA-N |
| XLogP | 6.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|