C29H27F4NO5S — CID 110166257
(2S,4aR,10bR)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide (PubChem CID 110166257) has the molecular formula C29H27F4NO5S and a molecular weight of 577.60 g/mol. Its IUPAC name is (2S,4aR,10bR)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide.
| Compound Name | (2S,4aR,10bR)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide |
|---|---|
| PubChem CID | 110166257 |
| Molecular Formula | C29H27F4NO5S |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | (2S,4aR,10bR)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxamide |
| SMILES | CC1(C)Oc2ccc(C(=O)NS(=O)(=O)c3ccccc3C(F)(F)F)cc2[C@@H]2O[C@H](Cc3ccc(F)cc3)CC[C@H]21 |
| InChI | InChI=1S/C29H27F4NO5S/c1-28(2)23-13-12-20(15-17-7-10-19(30)11-8-17)38-26(23)21-16-18(9-14-24(21)39-28)27(35)34-40(36,37)25-6-4-3-5-22(25)29(31,32)33/h3-11,14,16,20,23,26H,12-13,15H2,1-2H3,(H,34,35)/t20-,23+,26-/m0/s1 |
| InChIKey | LSEASNYJMOIARD-CLLDFNAGSA-N |
| XLogP | 6.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |