C27H31NO4 — CID 110166547
(E)-3-[4-[[(3R,4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine]-1'-yl]methyl]phenyl]prop-2-enoic acid (PubChem CID 110166547) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is (E)-3-[4-[[(3R,4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine]-1'-yl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(3R,4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine]-1'-yl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 110166547 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (E)-3-[4-[[(3R,4aS,10bS)-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine]-1'-yl]methyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(C)Oc2ccccc2[C@H]2OC[C@@]3(CCCN3Cc3ccc(/C=C/C(=O)O)cc3)C[C@@H]21 |
| InChI | InChI=1S/C27H31NO4/c1-26(2)22-16-27(18-31-25(22)21-6-3-4-7-23(21)32-26)14-5-15-28(27)17-20-10-8-19(9-11-20)12-13-24(29)30/h3-4,6-13,22,25H,5,14-18H2,1-2H3,(H,29,30)/b13-12+/t22-,25+,27+/m0/s1 |
| InChIKey | DAEWRYRIIOAOLW-BDXKCPEYSA-N |
| XLogP | 5.07 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|