C24H25N3O2 — CID 110167536
4-phenyl-2-[2-(2-phenylethyl)piperidin-1-yl]pyrimidine-5-carboxylic acid (PubChem CID 110167536) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-phenyl-2-[2-(2-phenylethyl)piperidin-1-yl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-phenyl-2-[2-(2-phenylethyl)piperidin-1-yl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 110167536 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-phenyl-2-[2-(2-phenylethyl)piperidin-1-yl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCCCC2CCc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2/c28-23(29)21-17-25-24(26-22(21)19-11-5-2-6-12-19)27-16-8-7-13-20(27)15-14-18-9-3-1-4-10-18/h1-6,9-12,17,20H,7-8,13-16H2,(H,28,29) |
| InChIKey | RLAMSBWQGMHYPK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |