C35H38N2O2 — CID 11016756
2-[[2,6-bis[(1R)-1-phenylbutoxy]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (PubChem CID 11016756) has the molecular formula C35H38N2O2 and a molecular weight of 518.70 g/mol. Its IUPAC name is 2-[[2,6-bis[(1R)-1-phenylbutoxy]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole.
| Compound Name | 2-[[2,6-bis[(1R)-1-phenylbutoxy]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 11016756 |
| Molecular Formula | C35H38N2O2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-[[2,6-bis[(1R)-1-phenylbutoxy]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| SMILES | CCC[C@@H](Oc1cccc(O[C@H](CCC)c2ccccc2)c1C(c1ccc[nH]1)c1ccc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C35H38N2O2/c1-3-14-30(26-16-7-5-8-17-26)38-32-22-11-23-33(39-31(15-4-2)27-18-9-6-10-19-27)35(32)34(28-20-12-24-36-28)29-21-13-25-37-29/h5-13,16-25,30-31,34,36-37H,3-4,14-15H2,1-2H3/t30-,31-/m1/s1 |
| InChIKey | ZAXNFUYIPUDHSE-FIRIVFDPSA-N |
| XLogP | 9.36 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |