About 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine
3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 110167685) has the molecular formula C18H14N4
and a molecular weight of 286.34 g/mol. Its IUPAC name is 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 110167685 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Nc1nc2c(-c3ccccc3)cnn2cc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N4/c19-17-16(14-9-5-2-6-10-14)12-22-18(21-17)15(11-20-22)13-7-3-1-4-8-13/h1-12H,(H2,19,21) |
| InChIKey | XDJQXAHFLYAOGT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine (CID 110167685) is 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine is Nc1nc2c(-c3ccccc3)cnn2cc1-c1ccccc1.
What is the InChIKey of 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is XDJQXAHFLYAOGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4/c19-17-16(14-9-5-2-6-10-14)12-22-18(21-17)15(11-20-22)13-7-3-1-4-8-13/h1-12H,(H2,19,21).
What are the key properties of 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine?
3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 286.34 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diphenylpyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 110167685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).