About 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide
1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 110168376) has the molecular formula C27H35F2N3O
and a molecular weight of 455.59 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| PubChem CID | 110168376 |
| Molecular Formula | C27H35F2N3O |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1(N2CCCCC2)CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H35F2N3O/c28-23-10-6-21(7-11-23)25(22-8-12-24(29)13-9-22)5-4-16-31-19-14-27(15-20-31,26(30)33)32-17-2-1-3-18-32/h6-13,25H,1-5,14-20H2,(H2,30,33) |
| InChIKey | GAOQRFMQAONHRJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide?
The IUPAC name of 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide (CID 110168376) is 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide.
What is the SMILES notation for 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide?
The canonical SMILES for 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide is NC(=O)C1(N2CCCCC2)CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide?
The InChIKey is GAOQRFMQAONHRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35F2N3O/c28-23-10-6-21(7-11-23)25(22-8-12-24(29)13-9-22)5-4-16-31-19-14-27(15-20-31,26(30)33)32-17-2-1-3-18-32/h6-13,25H,1-5,14-20H2,(H2,30,33).
What are the key properties of 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide?
1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide has a molecular weight of 455.59 g/mol, XLogP of 4.68, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidin-1-ylpiperidine-4-carboxamide is sourced from PubChem (CID 110168376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).