About 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate
4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate (PubChem CID 110168444) has the molecular formula C20H26ClF2NO
and a molecular weight of 369.88 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate.
Molecular Properties
| Compound Name | 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate |
| PubChem CID | 110168444 |
| Molecular Formula | C20H26ClF2NO |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate |
| SMILES | CC(C)(C)[NH2+]CCC=C(c1ccc(F)cc1)c1ccc(F)cc1.O.[Cl-] |
| InChI | InChI=1S/C20H23F2N.ClH.H2O/c1-20(2,3)23-14-4-5-19(15-6-10-17(21)11-7-15)16-8-12-18(22)13-9-16;;/h5-13,23H,4,14H2,1-3H3;1H;1H2 |
| InChIKey | KLBBTAKCQIIOAA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 48.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate?
The IUPAC name of 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate (CID 110168444) is 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate.
What is the SMILES notation for 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate?
The canonical SMILES for 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate is CC(C)(C)[NH2+]CCC=C(c1ccc(F)cc1)c1ccc(F)cc1.O.[Cl-].
What is the InChIKey of 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate?
The InChIKey is KLBBTAKCQIIOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2N.ClH.H2O/c1-20(2,3)23-14-4-5-19(15-6-10-17(21)11-7-15)16-8-12-18(22)13-9-16;;/h5-13,23H,4,14H2,1-3H3;1H;1H2.
What are the key properties of 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate?
4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate has a molecular weight of 369.88 g/mol, XLogP of 0.33, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(4-fluorophenyl)but-3-enyl-tert-butylazanium;chloride;hydrate is sourced from PubChem (CID 110168444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).