C21H22ClF2N — CID 110168451
1-[3-chloro-4,4-bis(4-fluorophenyl)but-3-enyl]piperidine (PubChem CID 110168451) has the molecular formula C21H22ClF2N and a molecular weight of 361.86 g/mol. Its IUPAC name is 1-[3-chloro-4,4-bis(4-fluorophenyl)but-3-enyl]piperidine.
| Compound Name | 1-[3-chloro-4,4-bis(4-fluorophenyl)but-3-enyl]piperidine |
|---|---|
| PubChem CID | 110168451 |
| Molecular Formula | C21H22ClF2N |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-[3-chloro-4,4-bis(4-fluorophenyl)but-3-enyl]piperidine |
| SMILES | Fc1ccc(C(=C(Cl)CCN2CCCCC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H22ClF2N/c22-20(12-15-25-13-2-1-3-14-25)21(16-4-8-18(23)9-5-16)17-6-10-19(24)11-7-17/h4-11H,1-3,12-15H2 |
| InChIKey | OQROFCLBXKLWTG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |