C20H22ClN3O2 — CID 110168464
3-[1-[2-(4-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 110168464) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 3-[1-[2-(4-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[2-(4-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 110168464 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-[1-[2-(4-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(CC(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O2/c21-15-7-5-14(6-8-15)19(25)13-23-11-9-16(10-12-23)24-18-4-2-1-3-17(18)22-20(24)26/h1-8,16,19,25H,9-13H2,(H,22,26) |
| InChIKey | ZWEOEMDRODVUND-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |