C16H12N4O — CID 110168823
5-benzo[b][1]benzazepin-11-yl-1,3,4-oxadiazol-2-amine (PubChem CID 110168823) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-benzo[b][1]benzazepin-11-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-benzo[b][1]benzazepin-11-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 110168823 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-benzo[b][1]benzazepin-11-yl-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(N2c3ccccc3C=Cc3ccccc32)o1 |
| InChI | InChI=1S/C16H12N4O/c17-15-18-19-16(21-15)20-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)20/h1-10H,(H2,17,18) |
| InChIKey | ZVEASJFAMWZIPD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|