C33H42O4Si — CID 11016890
(4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-1-ethoxy-6-methyl-5-phenylmethoxyhept-1-yn-4-ol (PubChem CID 11016890) has the molecular formula C33H42O4Si and a molecular weight of 530.78 g/mol. Its IUPAC name is (4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-1-ethoxy-6-methyl-5-phenylmethoxyhept-1-yn-4-ol.
| Compound Name | (4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-1-ethoxy-6-methyl-5-phenylmethoxyhept-1-yn-4-ol |
|---|---|
| PubChem CID | 11016890 |
| Molecular Formula | C33H42O4Si |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-1-ethoxy-6-methyl-5-phenylmethoxyhept-1-yn-4-ol |
| SMILES | CCOC#CC[C@H](O)[C@H](OCc1ccccc1)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H42O4Si/c1-6-35-24-16-23-31(34)32(36-26-28-17-10-7-11-18-28)27(2)25-37-38(33(3,4)5,29-19-12-8-13-20-29)30-21-14-9-15-22-30/h7-15,17-22,27,31-32,34H,6,23,25-26H2,1-5H3/t27-,31+,32-/m1/s1 |
| InChIKey | HDSGKICWLUPOBI-RKVVATLDSA-N |
| XLogP | 5.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|