C17H17N3O4 — CID 110170048
(3aR,7aS)-2-(5,6-dimethoxy-1H-indazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 110170048) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is (3aR,7aS)-2-(5,6-dimethoxy-1H-indazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-(5,6-dimethoxy-1H-indazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 110170048 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (3aR,7aS)-2-(5,6-dimethoxy-1H-indazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1cc2[nH]nc(N3C(=O)[C@H]4CC=CC[C@H]4C3=O)c2cc1OC |
| InChI | InChI=1S/C17H17N3O4/c1-23-13-7-11-12(8-14(13)24-2)18-19-15(11)20-16(21)9-5-3-4-6-10(9)17(20)22/h3-4,7-10H,5-6H2,1-2H3,(H,18,19)/t9-,10+ |
| InChIKey | GZIJVTQJTMQPJH-AOOOYVTPSA-N |
| XLogP | 2.04 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|