C13H15N5O2 — CID 110170669
2-(2-ethoxyethyl)-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 110170669) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 2-(2-ethoxyethyl)-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 110170669 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(2-ethoxyethyl)-7-(furan-2-yl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCOCCc1nc(N)n2nc(-c3ccco3)cc2n1 |
| InChI | InChI=1S/C13H15N5O2/c1-2-19-7-5-11-15-12-8-9(10-4-3-6-20-10)17-18(12)13(14)16-11/h3-4,6,8H,2,5,7H2,1H3,(H2,14,15,16) |
| InChIKey | RJPXECDUPDKXLY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|