C19H13BrN4 — CID 110170715
N-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-1-phenylmethanimine (PubChem CID 110170715) has the molecular formula C19H13BrN4 and a molecular weight of 377.25 g/mol. Its IUPAC name is N-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-1-phenylmethanimine.
| Compound Name | N-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 110170715 |
| Molecular Formula | C19H13BrN4 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-1-phenylmethanimine |
| SMILES | Brc1cnc2nc(-c3ccc(/N=C/c4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H13BrN4/c20-15-10-17-19(22-12-15)24-18(23-17)14-6-8-16(9-7-14)21-11-13-4-2-1-3-5-13/h1-12H,(H,22,23,24)/b21-11+ |
| InChIKey | NFZAYJLNCABESM-SRZZPIQSSA-N |
| XLogP | 5.14 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|