C25H23BrF3NO5 — CID 11017126
[(3R,4R)-3-bromo-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-b]quinolin-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11017126) has the molecular formula C25H23BrF3NO5 and a molecular weight of 554.36 g/mol. Its IUPAC name is [(3R,4R)-3-bromo-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-b]quinolin-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3R,4R)-3-bromo-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-b]quinolin-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11017126 |
| Molecular Formula | C25H23BrF3NO5 |
| Molecular Weight | 554.36 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | [(3R,4R)-3-bromo-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[2,3-b]quinolin-4-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COc1c2c(nc3ccccc13)OC(C)(C)[C@H](Br)[C@@H]2OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H23BrF3NO5/c1-23(2)20(26)19(17-18(32-3)15-12-8-9-13-16(15)30-21(17)35-23)34-22(31)24(33-4,25(27,28)29)14-10-6-5-7-11-14/h5-13,19-20H,1-4H3/t19-,20-,24-/m1/s1 |
| InChIKey | LDUCOKKYHQUDSZ-YOSAUDMPSA-N |
| XLogP | 5.87 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|