About 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine
1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 110171308) has the molecular formula C18H12Cl2FN5
and a molecular weight of 388.23 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 110171308 |
| Molecular Formula | C18H12Cl2FN5 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccccc2F)nc2c1cnn2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H12Cl2FN5/c19-13-5-3-6-14(20)12(13)9-26-18-11(8-23-26)16(22)24-17(25-18)10-4-1-2-7-15(10)21/h1-8H,9H2,(H2,22,24,25) |
| InChIKey | HXEKPBWKHUNEPG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (CID 110171308) is 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine is Nc1nc(-c2ccccc2F)nc2c1cnn2Cc1c(Cl)cccc1Cl.
What is the InChIKey of 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is HXEKPBWKHUNEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2FN5/c19-13-5-3-6-14(20)12(13)9-26-18-11(8-23-26)16(22)24-17(25-18)10-4-1-2-7-15(10)21/h1-8H,9H2,(H2,22,24,25).
What are the key properties of 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine?
1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 388.23 g/mol, XLogP of 4.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dichlorophenyl)methyl]-6-(2-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 110171308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).