About 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine
2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 110171350) has the molecular formula C18H13Br2N5
and a molecular weight of 459.15 g/mol. Its IUPAC name is 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 110171350 |
| Molecular Formula | C18H13Br2N5 |
| Molecular Weight | 459.15 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccccc2)nc2nn(Cc3c(Br)cccc3Br)cc12 |
| InChI | InChI=1S/C18H13Br2N5/c19-14-7-4-8-15(20)12(14)9-25-10-13-16(21)22-17(23-18(13)24-25)11-5-2-1-3-6-11/h1-8,10H,9H2,(H2,21,22,23,24) |
| InChIKey | UVWCNHWVPHHANN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.15 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine (CID 110171350) is 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine is Nc1nc(-c2ccccc2)nc2nn(Cc3c(Br)cccc3Br)cc12.
What is the InChIKey of 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is UVWCNHWVPHHANN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Br2N5/c19-14-7-4-8-15(20)12(14)9-25-10-13-16(21)22-17(23-18(13)24-25)11-5-2-1-3-6-11/h1-8,10H,9H2,(H2,21,22,23,24).
What are the key properties of 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine?
2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 459.15 g/mol, XLogP of 4.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dibromophenyl)methyl]-6-phenylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 110171350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).