C20H16N6O2 — CID 1101714
N-[[4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 1101714) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[[4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 1101714 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[[4-[(pyridine-4-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(C=NNC(=O)c2ccncc2)cc1)c1ccncc1 |
| InChI | InChI=1S/C20H16N6O2/c27-19(17-5-9-21-10-6-17)25-23-13-15-1-2-16(4-3-15)14-24-26-20(28)18-7-11-22-12-8-18/h1-14H,(H,25,27)(H,26,28) |
| InChIKey | JNYQEQUWGHEYNJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|