C15H16ClN3O4 — CID 110171525
4-(4-chlorophenoxy)-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)butanamide (PubChem CID 110171525) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)butanamide |
|---|---|
| PubChem CID | 110171525 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)butanamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1NC(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3O4/c1-9-13(14(21)19-15(22)17-9)18-12(20)3-2-8-23-11-6-4-10(16)5-7-11/h4-7H,2-3,8H2,1H3,(H,18,20)(H2,17,19,21,22) |
| InChIKey | GQPDWYBTSQVYON-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|