C28H50O9Si — CID 11017158
2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3R)-2-methoxy-4-methyl-1-oxopentan-3-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate (PubChem CID 11017158) has the molecular formula C28H50O9Si and a molecular weight of 558.79 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3R)-2-methoxy-4-methyl-1-oxopentan-3-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3R)-2-methoxy-4-methyl-1-oxopentan-3-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 11017158 |
| Molecular Formula | C28H50O9Si |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3R)-2-methoxy-4-methyl-1-oxopentan-3-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)/C(C)=C(\C(=O)OC(C)(C)C)[C@@H](CC(=O)O[C@H](C(C)C)[C@H](C=O)OC)O[Si](CC)(CC)C(C)C |
| InChI | InChI=1S/C28H50O9Si/c1-13-34-26(31)20(8)24(27(32)36-28(9,10)11)21(37-38(14-2,15-3)19(6)7)16-23(30)35-25(18(4)5)22(17-29)33-12/h17-19,21-22,25H,13-16H2,1-12H3/b24-20-/t21-,22+,25-/m1/s1 |
| InChIKey | WXCLJWBTPZVKRU-SNLONAFUSA-N |
| XLogP | 5.16 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|