C18H24N6O4S — CID 110171679
N-[3-(dimethylamino)propyl]-4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)benzenesulfonamide (PubChem CID 110171679) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)benzenesulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110171679 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)benzenesulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)c1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H24N6O4S/c1-22(2)11-5-10-19-29(27,28)13-8-6-12(7-9-13)15-20-14-16(21-15)23(3)18(26)24(4)17(14)25/h6-9,19H,5,10-11H2,1-4H3,(H,20,21) |
| InChIKey | AXYJTNSQPXSSAK-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|