C30H43NO8Si — CID 11017255
tert-butyl (2R,3R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-bis(methoxymethoxy)-5-oxopyrrolidine-1-carboxylate (PubChem CID 11017255) has the molecular formula C30H43NO8Si and a molecular weight of 573.76 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-bis(methoxymethoxy)-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-bis(methoxymethoxy)-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11017255 |
| Molecular Formula | C30H43NO8Si |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | tert-butyl (2R,3R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-bis(methoxymethoxy)-5-oxopyrrolidine-1-carboxylate |
| SMILES | COCO[C@H]1[C@H](OCOC)C(=O)N(C(=O)OC(C)(C)C)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H43NO8Si/c1-29(2,3)39-28(33)31-24(25(36-20-34-7)26(27(31)32)37-21-35-8)19-38-40(30(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,24-26H,19-21H2,1-8H3/t24-,25-,26+/m1/s1 |
| InChIKey | ROPAARLJXNNLDC-CYXNTTPDSA-N |
| XLogP | 3.69 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|