C15H15ClN4 — CID 110173071
6-chloro-3-cyclohexyl-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 110173071) has the molecular formula C15H15ClN4 and a molecular weight of 286.77 g/mol. Its IUPAC name is 6-chloro-3-cyclohexyl-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 6-chloro-3-cyclohexyl-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 110173071 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 6-chloro-3-cyclohexyl-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | Clc1nn2c(C3CCCCC3)nnc2c2ccccc12 |
| InChI | InChI=1S/C15H15ClN4/c16-13-11-8-4-5-9-12(11)15-18-17-14(20(15)19-13)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2 |
| InChIKey | WNWNULBSAUHOJV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |