C33H30O10 — CID 11017376
9-[[(2S,4R)-5,5-dimethyl-9'-(3-methylbut-2-enoxy)spiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]-4-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 11017376) has the molecular formula C33H30O10 and a molecular weight of 586.59 g/mol. Its IUPAC name is 9-[[(2S,4R)-5,5-dimethyl-9'-(3-methylbut-2-enoxy)spiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]-4-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 9-[[(2S,4R)-5,5-dimethyl-9'-(3-methylbut-2-enoxy)spiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11017376 |
| Molecular Formula | C33H30O10 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 9-[[(2S,4R)-5,5-dimethyl-9'-(3-methylbut-2-enoxy)spiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2ccoc2c(OC[C@H]2O[C@@]3(C=Cc4cc5ccoc5c(OCC=C(C)C)c4O3)OC2(C)C)c2oc(=O)ccc12 |
| InChI | InChI=1S/C33H30O10/c1-18(2)9-13-38-30-25-20(10-14-36-25)16-19-8-12-33(42-26(19)30)41-23(32(3,4)43-33)17-39-31-28-22(11-15-37-28)27(35-5)21-6-7-24(34)40-29(21)31/h6-12,14-16,23H,13,17H2,1-5H3/t23-,33-/m1/s1 |
| InChIKey | HCKXEUGWKJVWHW-PVAZPRTOSA-N |
| XLogP | 6.97 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|