About 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride
2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride (PubChem CID 110174347) has the molecular formula C20H24ClN3O3S
and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride.
Molecular Properties
| Compound Name | 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride |
| PubChem CID | 110174347 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride |
| SMILES | O=C(OCCOCC[NH+]1CCCC1)N1c2ccccc2Sc2cccnc21.[Cl-] |
| InChI | InChI=1S/C20H23N3O3S.ClH/c24-20(26-15-14-25-13-12-22-10-3-4-11-22)23-16-6-1-2-7-17(16)27-18-8-5-9-21-19(18)23;/h1-2,5-9H,3-4,10-15H2;1H |
| InChIKey | PIANKDQGVHBXIO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 56.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride?
The IUPAC name of 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride (CID 110174347) is 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride.
What is the SMILES notation for 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride?
The canonical SMILES for 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride is O=C(OCCOCC[NH+]1CCCC1)N1c2ccccc2Sc2cccnc21.[Cl-].
What is the InChIKey of 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride?
The InChIKey is PIANKDQGVHBXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3S.ClH/c24-20(26-15-14-25-13-12-22-10-3-4-11-22)23-16-6-1-2-7-17(16)27-18-8-5-9-21-19(18)23;/h1-2,5-9H,3-4,10-15H2;1H.
What are the key properties of 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride?
2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride has a molecular weight of 421.95 g/mol, XLogP of -0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pyrrolidin-1-ium-1-ylethoxy)ethyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate chloride is sourced from PubChem (CID 110174347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).