About 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone
1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone (PubChem CID 110174725) has the molecular formula C23H29NO5
and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone |
| PubChem CID | 110174725 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(C(O)C2CCCCN2CC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H29NO5/c1-27-18-10-7-16(8-11-18)23(26)19-6-4-5-13-24(19)15-20(25)17-9-12-21(28-2)22(14-17)29-3/h7-12,14,19,23,26H,4-6,13,15H2,1-3H3 |
| InChIKey | QERWCHQIZDFUEV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone (CID 110174725) is 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone is COc1ccc(C(O)C2CCCCN2CC(=O)c2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone?
The InChIKey is QERWCHQIZDFUEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO5/c1-27-18-10-7-16(8-11-18)23(26)19-6-4-5-13-24(19)15-20(25)17-9-12-21(28-2)22(14-17)29-3/h7-12,14,19,23,26H,4-6,13,15H2,1-3H3.
What are the key properties of 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone?
1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone has a molecular weight of 399.49 g/mol, XLogP of 3.48, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-2-[2-[hydroxy-(4-methoxyphenyl)methyl]piperidin-1-yl]ethanone is sourced from PubChem (CID 110174725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).