About [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride
[4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride (PubChem CID 110176159) has the molecular formula C14H14ClNO4
and a molecular weight of 295.72 g/mol. Its IUPAC name is [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride.
Molecular Properties
| Compound Name | [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride |
| PubChem CID | 110176159 |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride |
| SMILES | [Cl-].[NH3+]c1ccc(CC(=O)c2c(O)cc(O)cc2O)cc1 |
| InChI | InChI=1S/C14H13NO4.ClH/c15-9-3-1-8(2-4-9)5-11(17)14-12(18)6-10(16)7-13(14)19;/h1-4,6-7,16,18-19H,5,15H2;1H |
| InChIKey | YJBKXCKNGCSMII-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride?
The IUPAC name of [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride (CID 110176159) is [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride.
What is the SMILES notation for [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride?
The canonical SMILES for [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride is [Cl-].[NH3+]c1ccc(CC(=O)c2c(O)cc(O)cc2O)cc1.
What is the InChIKey of [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride?
The InChIKey is YJBKXCKNGCSMII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4.ClH/c15-9-3-1-8(2-4-9)5-11(17)14-12(18)6-10(16)7-13(14)19;/h1-4,6-7,16,18-19H,5,15H2;1H.
What are the key properties of [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride?
[4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride has a molecular weight of 295.72 g/mol, XLogP of -1.89, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl]phenyl]azanium chloride is sourced from PubChem (CID 110176159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).