C19H19ClN2O5S — CID 1101763
N-(3-acetylphenyl)-4-chloro-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 1101763) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-chloro-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(3-acetylphenyl)-4-chloro-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 1101763 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-(3-acetylphenyl)-4-chloro-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H19ClN2O5S/c1-13(23)14-3-2-4-16(11-14)21-19(24)15-5-6-17(20)18(12-15)28(25,26)22-7-9-27-10-8-22/h2-6,11-12H,7-10H2,1H3,(H,21,24) |
| InChIKey | ATCGVDYFJKGFLS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |