C10H16N2O3 — CID 110176309
5-[2-(2-aminoethylamino)-1-hydroxyethyl]benzene-1,3-diol (PubChem CID 110176309) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-[2-(2-aminoethylamino)-1-hydroxyethyl]benzene-1,3-diol.
| Compound Name | 5-[2-(2-aminoethylamino)-1-hydroxyethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 110176309 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-[2-(2-aminoethylamino)-1-hydroxyethyl]benzene-1,3-diol |
| SMILES | NCCNCC(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C10H16N2O3/c11-1-2-12-6-10(15)7-3-8(13)5-9(14)4-7/h3-5,10,12-15H,1-2,6,11H2 |
| InChIKey | XCHJXGQSPAKKMA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|