C33H41F3N2O7 — CID 11017648
12-O-tert-butyl 8-O-methyl (8S,11R,12S)-2,10-dioxo-11-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxylate (PubChem CID 11017648) has the molecular formula C33H41F3N2O7 and a molecular weight of 634.69 g/mol. Its IUPAC name is 12-O-tert-butyl 8-O-methyl (8S,11R,12S)-2,10-dioxo-11-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxylate.
| Compound Name | 12-O-tert-butyl 8-O-methyl (8S,11R,12S)-2,10-dioxo-11-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxylate |
|---|---|
| PubChem CID | 11017648 |
| Molecular Formula | C33H41F3N2O7 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 12-O-tert-butyl 8-O-methyl (8S,11R,12S)-2,10-dioxo-11-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CCCCNC(=O)OCCC[C@H](C(=O)OC(C)(C)C)[C@@H](Cc2ccc(-c3cccc(C(F)(F)F)c3)cc2)C(=O)N1 |
| InChI | InChI=1S/C33H41F3N2O7/c1-32(2,3)45-29(40)25-11-8-18-44-31(42)37-17-6-5-12-27(30(41)43-4)38-28(39)26(25)19-21-13-15-22(16-14-21)23-9-7-10-24(20-23)33(34,35)36/h7,9-10,13-16,20,25-27H,5-6,8,11-12,17-19H2,1-4H3,(H,37,42)(H,38,39)/t25-,26+,27-/m0/s1 |
| InChIKey | SDFVGNUJMBRMQE-VJGNERBWSA-N |
| XLogP | 5.84 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|