C24H25NO2 — CID 110176563
2-[(3-hydroxy-2-methyl-3,3-diphenylpropyl)amino]-1-phenylethanone (PubChem CID 110176563) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(3-hydroxy-2-methyl-3,3-diphenylpropyl)amino]-1-phenylethanone.
| Compound Name | 2-[(3-hydroxy-2-methyl-3,3-diphenylpropyl)amino]-1-phenylethanone |
|---|---|
| PubChem CID | 110176563 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[(3-hydroxy-2-methyl-3,3-diphenylpropyl)amino]-1-phenylethanone |
| SMILES | CC(CNCC(=O)c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO2/c1-19(17-25-18-23(26)20-11-5-2-6-12-20)24(27,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19,25,27H,17-18H2,1H3 |
| InChIKey | MXHJRKLAMBXYCW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |