C22H29Cl2NO3 — CID 110176655
[3-[3-(4-chlorobutoxy)phenyl]-3-oxopropyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride (PubChem CID 110176655) has the molecular formula C22H29Cl2NO3 and a molecular weight of 426.38 g/mol. Its IUPAC name is [3-[3-(4-chlorobutoxy)phenyl]-3-oxopropyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride.
| Compound Name | [3-[3-(4-chlorobutoxy)phenyl]-3-oxopropyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110176655 |
| Molecular Formula | C22H29Cl2NO3 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [3-[3-(4-chlorobutoxy)phenyl]-3-oxopropyl]-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
| SMILES | CC([NH2+]CCC(=O)c1cccc(OCCCCCl)c1)C(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H28ClNO3.ClH/c1-17(22(26)18-8-3-2-4-9-18)24-14-12-21(25)19-10-7-11-20(16-19)27-15-6-5-13-23;/h2-4,7-11,16-17,22,24,26H,5-6,12-15H2,1H3;1H |
| InChIKey | DIQKUQJUYLOODC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|