C25H27NO2 — CID 110176873
4-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1,3-diphenylbutan-2-one (PubChem CID 110176873) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1,3-diphenylbutan-2-one.
| Compound Name | 4-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1,3-diphenylbutan-2-one |
|---|---|
| PubChem CID | 110176873 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[(1-hydroxy-1-phenylpropan-2-yl)amino]-1,3-diphenylbutan-2-one |
| SMILES | CC(NCC(C(=O)Cc1ccccc1)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C25H27NO2/c1-19(25(28)22-15-9-4-10-16-22)26-18-23(21-13-7-3-8-14-21)24(27)17-20-11-5-2-6-12-20/h2-16,19,23,25-26,28H,17-18H2,1H3 |
| InChIKey | NMAKPXLZMMWECE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |