C27H32ClNO2 — CID 110177190
dimethyl-[3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]naphthalen-1-yl]oxypropyl]azanium chloride (PubChem CID 110177190) has the molecular formula C27H32ClNO2 and a molecular weight of 438.01 g/mol. Its IUPAC name is dimethyl-[3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]naphthalen-1-yl]oxypropyl]azanium chloride.
| Compound Name | dimethyl-[3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]naphthalen-1-yl]oxypropyl]azanium chloride |
|---|---|
| PubChem CID | 110177190 |
| Molecular Formula | C27H32ClNO2 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | dimethyl-[3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]naphthalen-1-yl]oxypropyl]azanium chloride |
| SMILES | CC(C)c1ccc(/C=C/C(=O)c2ccc(OCCC[NH+](C)C)c3ccccc23)cc1.[Cl-] |
| InChI | InChI=1S/C27H31NO2.ClH/c1-20(2)22-13-10-21(11-14-22)12-16-26(29)24-15-17-27(30-19-7-18-28(3)4)25-9-6-5-8-23(24)25;/h5-6,8-17,20H,7,18-19H2,1-4H3;1H/b16-12+; |
| InChIKey | AHUGZLNPXDSJMQ-CLNHMMGSSA-N |
| XLogP | 1.78 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|