C9H13Cl3N4O2 — CID 110178189
2-[4-(2-hydroxyethylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-ol (PubChem CID 110178189) has the molecular formula C9H13Cl3N4O2 and a molecular weight of 315.59 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-ol.
| Compound Name | 2-[4-(2-hydroxyethylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 110178189 |
| Molecular Formula | C9H13Cl3N4O2 |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-[4-(2-hydroxyethylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-ol |
| SMILES | CC(C)(O)c1nc(NCCO)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C9H13Cl3N4O2/c1-8(2,18)5-14-6(9(10,11)12)16-7(15-5)13-3-4-17/h17-18H,3-4H2,1-2H3,(H,13,14,15,16) |
| InChIKey | XKLCIJPFHMSXNG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|