C34H49N5O7S — CID 11017823
pentyl 3-[[(2S)-2-[[(2R)-2-[[(2S)-2-(1-aminoethylideneamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfinylbutanoyl]amino]-3-phenylpropanoyl]-methylamino]propanoate (PubChem CID 11017823) has the molecular formula C34H49N5O7S and a molecular weight of 671.86 g/mol. Its IUPAC name is pentyl 3-[[(2S)-2-[[(2R)-2-[[(2S)-2-(1-aminoethylideneamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfinylbutanoyl]amino]-3-phenylpropanoyl]-methylamino]propanoate.
| Compound Name | pentyl 3-[[(2S)-2-[[(2R)-2-[[(2S)-2-(1-aminoethylideneamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfinylbutanoyl]amino]-3-phenylpropanoyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 11017823 |
| Molecular Formula | C34H49N5O7S |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | pentyl 3-[[(2S)-2-[[(2R)-2-[[(2S)-2-(1-aminoethylideneamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfinylbutanoyl]amino]-3-phenylpropanoyl]-methylamino]propanoate |
| SMILES | CCCCCOC(=O)CCN(C)C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CCS(C)=O)NC(=O)[C@H](Cc1ccc(O)cc1)/N=C(\C)N |
| InChI | InChI=1S/C34H49N5O7S/c1-5-6-10-20-46-31(41)17-19-39(3)34(44)30(23-25-11-8-7-9-12-25)38-32(42)28(18-21-47(4)45)37-33(43)29(36-24(2)35)22-26-13-15-27(40)16-14-26/h7-9,11-16,28-30,40H,5-6,10,17-23H2,1-4H3,(H2,35,36)(H,37,43)(H,38,42)/t28-,29+,30+,47?/m1/s1 |
| InChIKey | JXMHFQBOPGUZKY-ASYYGURMSA-N |
| XLogP | 2.24 |
| TPSA | 180.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|