C19H21N3O5 — CID 110178338
ethyl N-[3-[[4-(ethoxycarbonylamino)benzoyl]amino]phenyl]carbamate (PubChem CID 110178338) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is ethyl N-[3-[[4-(ethoxycarbonylamino)benzoyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[4-(ethoxycarbonylamino)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 110178338 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl N-[3-[[4-(ethoxycarbonylamino)benzoyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C(=O)Nc2cccc(NC(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C19H21N3O5/c1-3-26-18(24)21-14-10-8-13(9-11-14)17(23)20-15-6-5-7-16(12-15)22-19(25)27-4-2/h5-12H,3-4H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | RKZAQOHPHONXDO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |