About 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride
2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride (PubChem CID 110178350) has the molecular formula C13H15Cl2N5
and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride.
Molecular Properties
| Compound Name | 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride |
| PubChem CID | 110178350 |
| Molecular Formula | C13H15Cl2N5 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride |
| SMILES | Clc1nc(-c2ccccc2)nc(N2CC[NH2+]CC2)n1.[Cl-] |
| InChI | InChI=1S/C13H14ClN5.ClH/c14-12-16-11(10-4-2-1-3-5-10)17-13(18-12)19-8-6-15-7-9-19;/h1-5,15H,6-9H2;1H |
| InChIKey | XAAIVTXBYCXZER-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride?
The IUPAC name of 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride (CID 110178350) is 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride.
What is the SMILES notation for 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride?
The canonical SMILES for 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride is Clc1nc(-c2ccccc2)nc(N2CC[NH2+]CC2)n1.[Cl-].
What is the InChIKey of 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride?
The InChIKey is XAAIVTXBYCXZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN5.ClH/c14-12-16-11(10-4-2-1-3-5-10)17-13(18-12)19-8-6-15-7-9-19;/h1-5,15H,6-9H2;1H.
What are the key properties of 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride?
2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride has a molecular weight of 312.20 g/mol, XLogP of -2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-phenyl-6-piperazin-4-ium-1-yl-1,3,5-triazine chloride is sourced from PubChem (CID 110178350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).